C38H54N4O7 — CID 10009756
4-[4-[[(3R)-1-butyl-3-[(R)-hydroxy(oxan-4-yl)methyl]-2,5-dioxo-1,4,9-triazaspiro[5.5]undecan-9-yl]methyl]phenoxy]-N-(2,2-dimethylpropyl)-3-methoxybenzamide (PubChem CID 10009756) has the molecular formula C38H54N4O7 and a molecular weight of 678.87 g/mol. Its IUPAC name is 4-[4-[[(3R)-1-butyl-3-[(R)-hydroxy(oxan-4-yl)methyl]-2,5-dioxo-1,4,9-triazaspiro[5.5]undecan-9-yl]methyl]phenoxy]-N-(2,2-dimethylpropyl)-3-methoxybenzamide.
| Compound Name | 4-[4-[[(3R)-1-butyl-3-[(R)-hydroxy(oxan-4-yl)methyl]-2,5-dioxo-1,4,9-triazaspiro[5.5]undecan-9-yl]methyl]phenoxy]-N-(2,2-dimethylpropyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 10009756 |
| Molecular Formula | C38H54N4O7 |
| Molecular Weight | 678.87 g/mol |
| Exact Mass | 678.40 |
| IUPAC Name | 4-[4-[[(3R)-1-butyl-3-[(R)-hydroxy(oxan-4-yl)methyl]-2,5-dioxo-1,4,9-triazaspiro[5.5]undecan-9-yl]methyl]phenoxy]-N-(2,2-dimethylpropyl)-3-methoxybenzamide |
| SMILES | CCCCN1C(=O)[C@@H]([C@H](O)C2CCOCC2)NC(=O)C12CCN(Cc1ccc(Oc3ccc(C(=O)NCC(C)(C)C)cc3OC)cc1)CC2 |
| InChI | InChI=1S/C38H54N4O7/c1-6-7-18-42-35(45)32(33(43)27-14-21-48-22-15-27)40-36(46)38(42)16-19-41(20-17-38)24-26-8-11-29(12-9-26)49-30-13-10-28(23-31(30)47-5)34(44)39-25-37(2,3)4/h8-13,23,27,32-33,43H,6-7,14-22,24-25H2,1-5H3,(H,39,44)(H,40,46)/t32-,33-/m1/s1 |
| InChIKey | IMPMVRWIADSZNZ-CZNDPXEESA-N |
| XLogP | 4.51 |
| TPSA | 129.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.87 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |