C48H60N4O6+2 — CID 10011109
N-[(2,4,6-trimethoxyphenyl)methyl]-1-[10-[4-[(2,4,6-trimethoxyphenyl)methylamino]quinolin-1-ium-1-yl]decyl]quinolin-1-ium-4-amine (PubChem CID 10011109) has the molecular formula C48H60N4O6+2 and a molecular weight of 789.03 g/mol. Its IUPAC name is N-[(2,4,6-trimethoxyphenyl)methyl]-1-[10-[4-[(2,4,6-trimethoxyphenyl)methylamino]quinolin-1-ium-1-yl]decyl]quinolin-1-ium-4-amine.
| Compound Name | N-[(2,4,6-trimethoxyphenyl)methyl]-1-[10-[4-[(2,4,6-trimethoxyphenyl)methylamino]quinolin-1-ium-1-yl]decyl]quinolin-1-ium-4-amine |
|---|---|
| PubChem CID | 10011109 |
| Molecular Formula | C48H60N4O6+2 |
| Molecular Weight | 789.03 g/mol |
| Exact Mass | 788.45 |
| IUPAC Name | N-[(2,4,6-trimethoxyphenyl)methyl]-1-[10-[4-[(2,4,6-trimethoxyphenyl)methylamino]quinolin-1-ium-1-yl]decyl]quinolin-1-ium-4-amine |
| SMILES | COc1cc(OC)c(CNc2cc[n+](CCCCCCCCCC[n+]3ccc(NCc4c(OC)cc(OC)cc4OC)c4ccccc43)c3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C48H58N4O6/c1-53-35-29-45(55-3)39(46(30-35)56-4)33-49-41-23-27-51(43-21-15-13-19-37(41)43)25-17-11-9-7-8-10-12-18-26-52-28-24-42(38-20-14-16-22-44(38)52)50-34-40-47(57-5)31-36(54-2)32-48(40)58-6/h13-16,19-24,27-32H,7-12,17-18,25-26,33-34H2,1-6H3/p+2 |
| InChIKey | DGRYUOHWQSFLKW-UHFFFAOYSA-P |
| XLogP | 9.66 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.03 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|