About 1,3-bis(1,10-phenanthrolin-3-yloxy)propan-2-amine
1,3-bis(1,10-phenanthrolin-3-yloxy)propan-2-amine (PubChem CID 10011125) has the molecular formula C27H21N5O2
and a molecular weight of 447.50 g/mol. Its IUPAC name is 1,3-bis(1,10-phenanthrolin-3-yloxy)propan-2-amine.
Molecular Properties
| Compound Name | 1,3-bis(1,10-phenanthrolin-3-yloxy)propan-2-amine |
| PubChem CID | 10011125 |
| Molecular Formula | C27H21N5O2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 1,3-bis(1,10-phenanthrolin-3-yloxy)propan-2-amine |
| SMILES | NC(COc1cnc2c(ccc3cccnc32)c1)COc1cnc2c(ccc3cccnc32)c1 |
| InChI | InChI=1S/C27H21N5O2/c28-21(15-33-22-11-19-7-5-17-3-1-9-29-24(17)26(19)31-13-22)16-34-23-12-20-8-6-18-4-2-10-30-25(18)27(20)32-14-23/h1-14,21H,15-16,28H2 |
| InChIKey | HPYPDGBOACEIRW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(1,10-phenanthrolin-3-yloxy)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(1,10-phenanthrolin-3-yloxy)propan-2-amine?
The IUPAC name of 1,3-bis(1,10-phenanthrolin-3-yloxy)propan-2-amine (CID 10011125) is 1,3-bis(1,10-phenanthrolin-3-yloxy)propan-2-amine.
What is the SMILES notation for 1,3-bis(1,10-phenanthrolin-3-yloxy)propan-2-amine?
The canonical SMILES for 1,3-bis(1,10-phenanthrolin-3-yloxy)propan-2-amine is NC(COc1cnc2c(ccc3cccnc32)c1)COc1cnc2c(ccc3cccnc32)c1.
What is the InChIKey of 1,3-bis(1,10-phenanthrolin-3-yloxy)propan-2-amine?
The InChIKey is HPYPDGBOACEIRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21N5O2/c28-21(15-33-22-11-19-7-5-17-3-1-9-29-24(17)26(19)31-13-22)16-34-23-12-20-8-6-18-4-2-10-30-25(18)27(20)32-14-23/h1-14,21H,15-16,28H2.
What are the key properties of 1,3-bis(1,10-phenanthrolin-3-yloxy)propan-2-amine?
1,3-bis(1,10-phenanthrolin-3-yloxy)propan-2-amine has a molecular weight of 447.50 g/mol, XLogP of 4.66, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(1,10-phenanthrolin-3-yloxy)propan-2-amine is sourced from PubChem (CID 10011125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).