C9H12O — CID 10011994
8,8,9,9,9-pentadeuterionona-3,6-diyn-1-ol (PubChem CID 10011994) has the molecular formula C9H12O and a molecular weight of 141.22 g/mol. Its IUPAC name is 8,8,9,9,9-pentadeuterionona-3,6-diyn-1-ol.
| Compound Name | 8,8,9,9,9-pentadeuterionona-3,6-diyn-1-ol |
|---|---|
| PubChem CID | 10011994 |
| Molecular Formula | C9H12O |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 8,8,9,9,9-pentadeuterionona-3,6-diyn-1-ol |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C#CCC#CCCO |
| InChI | InChI=1S/C9H12O/c1-2-3-4-5-6-7-8-9-10/h10H,2,5,8-9H2,1H3/i1D3,2D2 |
| InChIKey | ASBDYPIHQWUNHE-ZBJDZAJPSA-N |
| XLogP | 1.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|