3-ethylpentanedioic acid

C7H12O4 — CID 10012172

IUPAC3-ethylpentanedioic acid
SMILESCCC(CC(=O)O)CC(=O)O
InChIInChI=1S/C7H12O4/c1-2-5(3-6(8)9)4-7(10)11/h5H,2-4H2,1H3,(H,8,9)(H,10,11)
InChIKeyVDAVARPTDLMJIC-UHFFFAOYSA-N
MW160.17 g/mol
LogP0.96
Rot. Bonds5

About 3-ethylpentanedioic acid

3-ethylpentanedioic acid (PubChem CID 10012172) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is 3-ethylpentanedioic acid.

Molecular Properties

Compound Name3-ethylpentanedioic acid
PubChem CID10012172
Molecular FormulaC7H12O4
Molecular Weight160.17 g/mol
Exact Mass160.07
IUPAC Name3-ethylpentanedioic acid
SMILESCCC(CC(=O)O)CC(=O)O
InChIInChI=1S/C7H12O4/c1-2-5(3-6(8)9)4-7(10)11/h5H,2-4H2,1H3,(H,8,9)(H,10,11)
InChIKeyVDAVARPTDLMJIC-UHFFFAOYSA-N
XLogP0.96
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.17
LogP ≤ 50.96
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-ethylpentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-ethylpentanedioic acid?
The IUPAC name of 3-ethylpentanedioic acid (CID 10012172) is 3-ethylpentanedioic acid.
What is the SMILES notation for 3-ethylpentanedioic acid?
The canonical SMILES for 3-ethylpentanedioic acid is CCC(CC(=O)O)CC(=O)O.
What is the InChIKey of 3-ethylpentanedioic acid?
The InChIKey is VDAVARPTDLMJIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4/c1-2-5(3-6(8)9)4-7(10)11/h5H,2-4H2,1H3,(H,8,9)(H,10,11).
What are the key properties of 3-ethylpentanedioic acid?
3-ethylpentanedioic acid has a molecular weight of 160.17 g/mol, XLogP of 0.96, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylpentanedioic acid is sourced from PubChem (CID 10012172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).