About (2S)-2,3-diamino-1-piperidin-1-ylpropan-1-one
(2S)-2,3-diamino-1-piperidin-1-ylpropan-1-one (PubChem CID 10012350) has the molecular formula C8H17N3O
and a molecular weight of 171.24 g/mol. Its IUPAC name is (2S)-2,3-diamino-1-piperidin-1-ylpropan-1-one.
Molecular Properties
| Compound Name | (2S)-2,3-diamino-1-piperidin-1-ylpropan-1-one |
| PubChem CID | 10012350 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | (2S)-2,3-diamino-1-piperidin-1-ylpropan-1-one |
| SMILES | NC[C@H](N)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C8H17N3O/c9-6-7(10)8(12)11-4-2-1-3-5-11/h7H,1-6,9-10H2/t7-/m0/s1 |
| InChIKey | JVCNLFFNIXVBAD-ZETCQYMHSA-N |
| XLogP | -0.72 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2,3-diamino-1-piperidin-1-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,3-diamino-1-piperidin-1-ylpropan-1-one?
The IUPAC name of (2S)-2,3-diamino-1-piperidin-1-ylpropan-1-one (CID 10012350) is (2S)-2,3-diamino-1-piperidin-1-ylpropan-1-one.
What is the SMILES notation for (2S)-2,3-diamino-1-piperidin-1-ylpropan-1-one?
The canonical SMILES for (2S)-2,3-diamino-1-piperidin-1-ylpropan-1-one is NC[C@H](N)C(=O)N1CCCCC1.
What is the InChIKey of (2S)-2,3-diamino-1-piperidin-1-ylpropan-1-one?
The InChIKey is JVCNLFFNIXVBAD-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H17N3O/c9-6-7(10)8(12)11-4-2-1-3-5-11/h7H,1-6,9-10H2/t7-/m0/s1.
What are the key properties of (2S)-2,3-diamino-1-piperidin-1-ylpropan-1-one?
(2S)-2,3-diamino-1-piperidin-1-ylpropan-1-one has a molecular weight of 171.24 g/mol, XLogP of -0.72, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,3-diamino-1-piperidin-1-ylpropan-1-one is sourced from PubChem (CID 10012350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).