About 1,3,6-trimethylpyrano[4,3-b]pyrrol-4-one
1,3,6-trimethylpyrano[4,3-b]pyrrol-4-one (PubChem CID 10012461) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is 1,3,6-trimethylpyrano[4,3-b]pyrrol-4-one.
Molecular Properties
| Compound Name | 1,3,6-trimethylpyrano[4,3-b]pyrrol-4-one |
| PubChem CID | 10012461 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 1,3,6-trimethylpyrano[4,3-b]pyrrol-4-one |
| SMILES | Cc1cc2c(c(C)cn2C)c(=O)o1 |
| InChI | InChI=1S/C10H11NO2/c1-6-5-11(3)8-4-7(2)13-10(12)9(6)8/h4-5H,1-3H3 |
| InChIKey | APVMUXPXCLZNAD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3,6-trimethylpyrano[4,3-b]pyrrol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,6-trimethylpyrano[4,3-b]pyrrol-4-one?
The IUPAC name of 1,3,6-trimethylpyrano[4,3-b]pyrrol-4-one (CID 10012461) is 1,3,6-trimethylpyrano[4,3-b]pyrrol-4-one.
What is the SMILES notation for 1,3,6-trimethylpyrano[4,3-b]pyrrol-4-one?
The canonical SMILES for 1,3,6-trimethylpyrano[4,3-b]pyrrol-4-one is Cc1cc2c(c(C)cn2C)c(=O)o1.
What is the InChIKey of 1,3,6-trimethylpyrano[4,3-b]pyrrol-4-one?
The InChIKey is APVMUXPXCLZNAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c1-6-5-11(3)8-4-7(2)13-10(12)9(6)8/h4-5H,1-3H3.
What are the key properties of 1,3,6-trimethylpyrano[4,3-b]pyrrol-4-one?
1,3,6-trimethylpyrano[4,3-b]pyrrol-4-one has a molecular weight of 177.20 g/mol, XLogP of 1.75, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,6-trimethylpyrano[4,3-b]pyrrol-4-one is sourced from PubChem (CID 10012461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).