About 3-phenylmethoxypyridine
3-phenylmethoxypyridine (PubChem CID 10012635) has the molecular formula C12H11NO
and a molecular weight of 185.23 g/mol. Its IUPAC name is 3-phenylmethoxypyridine.
Molecular Properties
| Compound Name | 3-phenylmethoxypyridine |
| PubChem CID | 10012635 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 3-phenylmethoxypyridine |
| SMILES | c1ccc(COc2cccnc2)cc1 |
| InChI | InChI=1S/C12H11NO/c1-2-5-11(6-3-1)10-14-12-7-4-8-13-9-12/h1-9H,10H2 |
| InChIKey | LLWFWIZOFFLRKC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenylmethoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylmethoxypyridine?
The IUPAC name of 3-phenylmethoxypyridine (CID 10012635) is 3-phenylmethoxypyridine.
What is the SMILES notation for 3-phenylmethoxypyridine?
The canonical SMILES for 3-phenylmethoxypyridine is c1ccc(COc2cccnc2)cc1.
What is the InChIKey of 3-phenylmethoxypyridine?
The InChIKey is LLWFWIZOFFLRKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO/c1-2-5-11(6-3-1)10-14-12-7-4-8-13-9-12/h1-9H,10H2.
What are the key properties of 3-phenylmethoxypyridine?
3-phenylmethoxypyridine has a molecular weight of 185.23 g/mol, XLogP of 2.66, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylmethoxypyridine is sourced from PubChem (CID 10012635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).