About methyl 1-oxo-2,3-dihydroindene-4-carboxylate
methyl 1-oxo-2,3-dihydroindene-4-carboxylate (PubChem CID 10012730) has the molecular formula C11H10O3
and a molecular weight of 190.20 g/mol. Its IUPAC name is methyl 1-oxo-2,3-dihydroindene-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-oxo-2,3-dihydroindene-4-carboxylate |
| PubChem CID | 10012730 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | methyl 1-oxo-2,3-dihydroindene-4-carboxylate |
| SMILES | COC(=O)c1cccc2c1CCC2=O |
| InChI | InChI=1S/C11H10O3/c1-14-11(13)9-4-2-3-8-7(9)5-6-10(8)12/h2-4H,5-6H2,1H3 |
| InChIKey | PGGSYJMONFCBEJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 1-oxo-2,3-dihydroindene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-oxo-2,3-dihydroindene-4-carboxylate?
The IUPAC name of methyl 1-oxo-2,3-dihydroindene-4-carboxylate (CID 10012730) is methyl 1-oxo-2,3-dihydroindene-4-carboxylate.
What is the SMILES notation for methyl 1-oxo-2,3-dihydroindene-4-carboxylate?
The canonical SMILES for methyl 1-oxo-2,3-dihydroindene-4-carboxylate is COC(=O)c1cccc2c1CCC2=O.
What is the InChIKey of methyl 1-oxo-2,3-dihydroindene-4-carboxylate?
The InChIKey is PGGSYJMONFCBEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O3/c1-14-11(13)9-4-2-3-8-7(9)5-6-10(8)12/h2-4H,5-6H2,1H3.
What are the key properties of methyl 1-oxo-2,3-dihydroindene-4-carboxylate?
methyl 1-oxo-2,3-dihydroindene-4-carboxylate has a molecular weight of 190.20 g/mol, XLogP of 1.60, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-oxo-2,3-dihydroindene-4-carboxylate is sourced from PubChem (CID 10012730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).