C9H12N4O — CID 10012796
5,6-dimethyl-N-prop-2-enyl-1,2,4-triazine-3-carboxamide (PubChem CID 10012796) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is 5,6-dimethyl-N-prop-2-enyl-1,2,4-triazine-3-carboxamide.
| Compound Name | 5,6-dimethyl-N-prop-2-enyl-1,2,4-triazine-3-carboxamide |
|---|---|
| PubChem CID | 10012796 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 5,6-dimethyl-N-prop-2-enyl-1,2,4-triazine-3-carboxamide |
| SMILES | C=CCNC(=O)c1nnc(C)c(C)n1 |
| InChI | InChI=1S/C9H12N4O/c1-4-5-10-9(14)8-11-6(2)7(3)12-13-8/h4H,1,5H2,2-3H3,(H,10,14) |
| InChIKey | SLFAVUGXAUULSY-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|