About 2-(1,7-diazaspiro[4.4]nonan-7-yl)-1,3,4-oxadiazole
2-(1,7-diazaspiro[4.4]nonan-7-yl)-1,3,4-oxadiazole (PubChem CID 10012861) has the molecular formula C9H14N4O
and a molecular weight of 194.24 g/mol. Its IUPAC name is 2-(1,7-diazaspiro[4.4]nonan-7-yl)-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-(1,7-diazaspiro[4.4]nonan-7-yl)-1,3,4-oxadiazole |
| PubChem CID | 10012861 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2-(1,7-diazaspiro[4.4]nonan-7-yl)-1,3,4-oxadiazole |
| SMILES | c1nnc(N2CCC3(CCCN3)C2)o1 |
| InChI | InChI=1S/C9H14N4O/c1-2-9(10-4-1)3-5-13(6-9)8-12-11-7-14-8/h7,10H,1-6H2 |
| InChIKey | YSANUTMNEXHJIE-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,7-diazaspiro[4.4]nonan-7-yl)-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,7-diazaspiro[4.4]nonan-7-yl)-1,3,4-oxadiazole?
The IUPAC name of 2-(1,7-diazaspiro[4.4]nonan-7-yl)-1,3,4-oxadiazole (CID 10012861) is 2-(1,7-diazaspiro[4.4]nonan-7-yl)-1,3,4-oxadiazole.
What is the SMILES notation for 2-(1,7-diazaspiro[4.4]nonan-7-yl)-1,3,4-oxadiazole?
The canonical SMILES for 2-(1,7-diazaspiro[4.4]nonan-7-yl)-1,3,4-oxadiazole is c1nnc(N2CCC3(CCCN3)C2)o1.
What is the InChIKey of 2-(1,7-diazaspiro[4.4]nonan-7-yl)-1,3,4-oxadiazole?
The InChIKey is YSANUTMNEXHJIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O/c1-2-9(10-4-1)3-5-13(6-9)8-12-11-7-14-8/h7,10H,1-6H2.
What are the key properties of 2-(1,7-diazaspiro[4.4]nonan-7-yl)-1,3,4-oxadiazole?
2-(1,7-diazaspiro[4.4]nonan-7-yl)-1,3,4-oxadiazole has a molecular weight of 194.24 g/mol, XLogP of 0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,7-diazaspiro[4.4]nonan-7-yl)-1,3,4-oxadiazole is sourced from PubChem (CID 10012861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).