C9H18N4O — CID 10012974
3-amino-N-(3-amino-3-iminopropyl)cyclopentane-1-carboxamide (PubChem CID 10012974) has the molecular formula C9H18N4O and a molecular weight of 198.27 g/mol. Its IUPAC name is 3-amino-N-(3-amino-3-iminopropyl)cyclopentane-1-carboxamide.
| Compound Name | 3-amino-N-(3-amino-3-iminopropyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 10012974 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | 3-amino-N-(3-amino-3-iminopropyl)cyclopentane-1-carboxamide |
| SMILES | [H]/N=C(\N)CCNC(=O)C1CCC(N)C1 |
| InChI | InChI=1S/C9H18N4O/c10-7-2-1-6(5-7)9(14)13-4-3-8(11)12/h6-7H,1-5,10H2,(H3,11,12)(H,13,14) |
| InChIKey | YLJXZSWHZFXCDY-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 104.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|