About 2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1-benzothiophen-3-one
2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1-benzothiophen-3-one (PubChem CID 1001299) has the molecular formula C16H9BrO3S
and a molecular weight of 361.22 g/mol. Its IUPAC name is 2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1-benzothiophen-3-one.
Molecular Properties
| Compound Name | 2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1-benzothiophen-3-one |
| PubChem CID | 1001299 |
| Molecular Formula | C16H9BrO3S |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 359.95 |
| IUPAC Name | 2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1-benzothiophen-3-one |
| SMILES | O=C1C(=Cc2cc3c(cc2Br)OCO3)Sc2ccccc21 |
| InChI | InChI=1S/C16H9BrO3S/c17-11-7-13-12(19-8-20-13)5-9(11)6-15-16(18)10-3-1-2-4-14(10)21-15/h1-7H,8H2 |
| InChIKey | PMDHYZFHEBEDHH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_F(15)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1-benzothiophen-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1-benzothiophen-3-one?
The IUPAC name of 2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1-benzothiophen-3-one (CID 1001299) is 2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1-benzothiophen-3-one.
What is the SMILES notation for 2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1-benzothiophen-3-one?
The canonical SMILES for 2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1-benzothiophen-3-one is O=C1C(=Cc2cc3c(cc2Br)OCO3)Sc2ccccc21.
What is the InChIKey of 2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1-benzothiophen-3-one?
The InChIKey is PMDHYZFHEBEDHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9BrO3S/c17-11-7-13-12(19-8-20-13)5-9(11)6-15-16(18)10-3-1-2-4-14(10)21-15/h1-7H,8H2.
What are the key properties of 2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1-benzothiophen-3-one?
2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1-benzothiophen-3-one has a molecular weight of 361.22 g/mol, XLogP of 4.51, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1-benzothiophen-3-one is sourced from PubChem (CID 1001299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).