C8H14O4Si — CID 10013093
(1S,2S,3S,6S)-1-[hydroxy(dimethyl)silyl]-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol (PubChem CID 10013093) has the molecular formula C8H14O4Si and a molecular weight of 202.28 g/mol. Its IUPAC name is (1S,2S,3S,6S)-1-[hydroxy(dimethyl)silyl]-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol.
| Compound Name | (1S,2S,3S,6S)-1-[hydroxy(dimethyl)silyl]-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol |
|---|---|
| PubChem CID | 10013093 |
| Molecular Formula | C8H14O4Si |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | (1S,2S,3S,6S)-1-[hydroxy(dimethyl)silyl]-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol |
| SMILES | C[Si](C)(O)[C@]12O[C@H]1C=C[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C8H14O4Si/c1-13(2,11)8-6(12-8)4-3-5(9)7(8)10/h3-7,9-11H,1-2H3/t5-,6-,7-,8+/m0/s1 |
| InChIKey | UPWZBAXCWSZWQX-DKXJUACHSA-N |
| XLogP | -0.85 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|