About (4S)-4-benzyl-2,4-dimethyl-1,3-oxazol-5-one
(4S)-4-benzyl-2,4-dimethyl-1,3-oxazol-5-one (PubChem CID 10013127) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is (4S)-4-benzyl-2,4-dimethyl-1,3-oxazol-5-one.
Molecular Properties
| Compound Name | (4S)-4-benzyl-2,4-dimethyl-1,3-oxazol-5-one |
| PubChem CID | 10013127 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (4S)-4-benzyl-2,4-dimethyl-1,3-oxazol-5-one |
| SMILES | CC1=N[C@@](C)(Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C12H13NO2/c1-9-13-12(2,11(14)15-9)8-10-6-4-3-5-7-10/h3-7H,8H2,1-2H3/t12-/m0/s1 |
| InChIKey | SGPCDAPPCJLKBY-LBPRGKRZSA-N |
| XLogP | 1.96 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-4-benzyl-2,4-dimethyl-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-benzyl-2,4-dimethyl-1,3-oxazol-5-one?
The IUPAC name of (4S)-4-benzyl-2,4-dimethyl-1,3-oxazol-5-one (CID 10013127) is (4S)-4-benzyl-2,4-dimethyl-1,3-oxazol-5-one.
What is the SMILES notation for (4S)-4-benzyl-2,4-dimethyl-1,3-oxazol-5-one?
The canonical SMILES for (4S)-4-benzyl-2,4-dimethyl-1,3-oxazol-5-one is CC1=N[C@@](C)(Cc2ccccc2)C(=O)O1.
What is the InChIKey of (4S)-4-benzyl-2,4-dimethyl-1,3-oxazol-5-one?
The InChIKey is SGPCDAPPCJLKBY-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H13NO2/c1-9-13-12(2,11(14)15-9)8-10-6-4-3-5-7-10/h3-7H,8H2,1-2H3/t12-/m0/s1.
What are the key properties of (4S)-4-benzyl-2,4-dimethyl-1,3-oxazol-5-one?
(4S)-4-benzyl-2,4-dimethyl-1,3-oxazol-5-one has a molecular weight of 203.24 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-benzyl-2,4-dimethyl-1,3-oxazol-5-one is sourced from PubChem (CID 10013127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).