About 2-pyrrolo[2,3-b]pyridin-1-ylethyl acetate
2-pyrrolo[2,3-b]pyridin-1-ylethyl acetate (PubChem CID 10013153) has the molecular formula C11H12N2O2
and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-pyrrolo[2,3-b]pyridin-1-ylethyl acetate.
Molecular Properties
| Compound Name | 2-pyrrolo[2,3-b]pyridin-1-ylethyl acetate |
| PubChem CID | 10013153 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-pyrrolo[2,3-b]pyridin-1-ylethyl acetate |
| SMILES | CC(=O)OCCn1ccc2cccnc21 |
| InChI | InChI=1S/C11H12N2O2/c1-9(14)15-8-7-13-6-4-10-3-2-5-12-11(10)13/h2-6H,7-8H2,1H3 |
| InChIKey | RFRDHKNKZMCUJW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-pyrrolo[2,3-b]pyridin-1-ylethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolo[2,3-b]pyridin-1-ylethyl acetate?
The IUPAC name of 2-pyrrolo[2,3-b]pyridin-1-ylethyl acetate (CID 10013153) is 2-pyrrolo[2,3-b]pyridin-1-ylethyl acetate.
What is the SMILES notation for 2-pyrrolo[2,3-b]pyridin-1-ylethyl acetate?
The canonical SMILES for 2-pyrrolo[2,3-b]pyridin-1-ylethyl acetate is CC(=O)OCCn1ccc2cccnc21.
What is the InChIKey of 2-pyrrolo[2,3-b]pyridin-1-ylethyl acetate?
The InChIKey is RFRDHKNKZMCUJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2/c1-9(14)15-8-7-13-6-4-10-3-2-5-12-11(10)13/h2-6H,7-8H2,1H3.
What are the key properties of 2-pyrrolo[2,3-b]pyridin-1-ylethyl acetate?
2-pyrrolo[2,3-b]pyridin-1-ylethyl acetate has a molecular weight of 204.23 g/mol, XLogP of 1.60, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolo[2,3-b]pyridin-1-ylethyl acetate is sourced from PubChem (CID 10013153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).