About 1-pyrazin-2-yl-1,7-diazaspiro[4.4]nonane
1-pyrazin-2-yl-1,7-diazaspiro[4.4]nonane (PubChem CID 10013163) has the molecular formula C11H16N4
and a molecular weight of 204.28 g/mol. Its IUPAC name is 1-pyrazin-2-yl-1,7-diazaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 1-pyrazin-2-yl-1,7-diazaspiro[4.4]nonane |
| PubChem CID | 10013163 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 1-pyrazin-2-yl-1,7-diazaspiro[4.4]nonane |
| SMILES | c1cnc(N2CCCC23CCNC3)cn1 |
| InChI | InChI=1S/C11H16N4/c1-2-11(3-4-13-9-11)15(7-1)10-8-12-5-6-14-10/h5-6,8,13H,1-4,7,9H2 |
| InChIKey | UTDCHRIOAZMHNF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-pyrazin-2-yl-1,7-diazaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrazin-2-yl-1,7-diazaspiro[4.4]nonane?
The IUPAC name of 1-pyrazin-2-yl-1,7-diazaspiro[4.4]nonane (CID 10013163) is 1-pyrazin-2-yl-1,7-diazaspiro[4.4]nonane.
What is the SMILES notation for 1-pyrazin-2-yl-1,7-diazaspiro[4.4]nonane?
The canonical SMILES for 1-pyrazin-2-yl-1,7-diazaspiro[4.4]nonane is c1cnc(N2CCCC23CCNC3)cn1.
What is the InChIKey of 1-pyrazin-2-yl-1,7-diazaspiro[4.4]nonane?
The InChIKey is UTDCHRIOAZMHNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4/c1-2-11(3-4-13-9-11)15(7-1)10-8-12-5-6-14-10/h5-6,8,13H,1-4,7,9H2.
What are the key properties of 1-pyrazin-2-yl-1,7-diazaspiro[4.4]nonane?
1-pyrazin-2-yl-1,7-diazaspiro[4.4]nonane has a molecular weight of 204.28 g/mol, XLogP of 0.81, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrazin-2-yl-1,7-diazaspiro[4.4]nonane is sourced from PubChem (CID 10013163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).