About (6R,10R)-10-hydroxy-1,7-dithiaspiro[5.5]undecan-4-one
(6R,10R)-10-hydroxy-1,7-dithiaspiro[5.5]undecan-4-one (PubChem CID 10013663) has the molecular formula C9H14O2S2
and a molecular weight of 218.34 g/mol. Its IUPAC name is (6R,10R)-10-hydroxy-1,7-dithiaspiro[5.5]undecan-4-one.
Molecular Properties
| Compound Name | (6R,10R)-10-hydroxy-1,7-dithiaspiro[5.5]undecan-4-one |
| PubChem CID | 10013663 |
| Molecular Formula | C9H14O2S2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | (6R,10R)-10-hydroxy-1,7-dithiaspiro[5.5]undecan-4-one |
| SMILES | O=C1CCS[C@@]2(C1)C[C@H](O)CCS2 |
| InChI | InChI=1S/C9H14O2S2/c10-7-1-3-12-9(5-7)6-8(11)2-4-13-9/h7,10H,1-6H2/t7-,9-/m1/s1 |
| InChIKey | IPOWSLOIPJDIRR-VXNVDRBHSA-N |
| XLogP | 1.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6R,10R)-10-hydroxy-1,7-dithiaspiro[5.5]undecan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R,10R)-10-hydroxy-1,7-dithiaspiro[5.5]undecan-4-one?
The IUPAC name of (6R,10R)-10-hydroxy-1,7-dithiaspiro[5.5]undecan-4-one (CID 10013663) is (6R,10R)-10-hydroxy-1,7-dithiaspiro[5.5]undecan-4-one.
What is the SMILES notation for (6R,10R)-10-hydroxy-1,7-dithiaspiro[5.5]undecan-4-one?
The canonical SMILES for (6R,10R)-10-hydroxy-1,7-dithiaspiro[5.5]undecan-4-one is O=C1CCS[C@@]2(C1)C[C@H](O)CCS2.
What is the InChIKey of (6R,10R)-10-hydroxy-1,7-dithiaspiro[5.5]undecan-4-one?
The InChIKey is IPOWSLOIPJDIRR-VXNVDRBHSA-N. The full InChI is InChI=1S/C9H14O2S2/c10-7-1-3-12-9(5-7)6-8(11)2-4-13-9/h7,10H,1-6H2/t7-,9-/m1/s1.
What are the key properties of (6R,10R)-10-hydroxy-1,7-dithiaspiro[5.5]undecan-4-one?
(6R,10R)-10-hydroxy-1,7-dithiaspiro[5.5]undecan-4-one has a molecular weight of 218.34 g/mol, XLogP of 1.67, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6R,10R)-10-hydroxy-1,7-dithiaspiro[5.5]undecan-4-one is sourced from PubChem (CID 10013663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).