C9H17NOS2 — CID 10013713
(NE)-N-[4-(2-ethyl-1,3-dithiolan-2-yl)butan-2-ylidene]hydroxylamine (PubChem CID 10013713) has the molecular formula C9H17NOS2 and a molecular weight of 219.37 g/mol. Its IUPAC name is (NE)-N-[4-(2-ethyl-1,3-dithiolan-2-yl)butan-2-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[4-(2-ethyl-1,3-dithiolan-2-yl)butan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 10013713 |
| Molecular Formula | C9H17NOS2 |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | (NE)-N-[4-(2-ethyl-1,3-dithiolan-2-yl)butan-2-ylidene]hydroxylamine |
| SMILES | CCC1(CC/C(C)=N/O)SCCS1 |
| InChI | InChI=1S/C9H17NOS2/c1-3-9(12-6-7-13-9)5-4-8(2)10-11/h11H,3-7H2,1-2H3/b10-8+ |
| InChIKey | RQRNNLZEAUAHOG-CSKARUKUSA-N |
| XLogP | 3.20 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|