C13H20OSi — CID 10013757
[(2Z,6Z)-1-ethynylcycloocta-2,6-dien-1-yl]oxy-trimethylsilane (PubChem CID 10013757) has the molecular formula C13H20OSi and a molecular weight of 220.39 g/mol. Its IUPAC name is [(2Z,6Z)-1-ethynylcycloocta-2,6-dien-1-yl]oxy-trimethylsilane.
| Compound Name | [(2Z,6Z)-1-ethynylcycloocta-2,6-dien-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10013757 |
| Molecular Formula | C13H20OSi |
| Molecular Weight | 220.39 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | [(2Z,6Z)-1-ethynylcycloocta-2,6-dien-1-yl]oxy-trimethylsilane |
| SMILES | C#CC1(O[Si](C)(C)C)/C=C\CC/C=C\C1 |
| InChI | InChI=1S/C13H20OSi/c1-5-13(14-15(2,3)4)11-9-7-6-8-10-12-13/h1,7,9-10,12H,6,8,11H2,2-4H3/b9-7-,12-10- |
| InChIKey | WEPGYHCLIDDKNB-GEHMVYPESA-N |
| XLogP | 3.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|