About (2S)-2-ethyl-8-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one
(2S)-2-ethyl-8-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one (PubChem CID 10014086) has the molecular formula C10H18N2O2S
and a molecular weight of 230.33 g/mol. Its IUPAC name is (2S)-2-ethyl-8-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one.
Molecular Properties
| Compound Name | (2S)-2-ethyl-8-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one |
| PubChem CID | 10014086 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | (2S)-2-ethyl-8-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one |
| SMILES | CC[C@H]1C(=O)NC2(CCN(C)CC2)S1=O |
| InChI | InChI=1S/C10H18N2O2S/c1-3-8-9(13)11-10(15(8)14)4-6-12(2)7-5-10/h8H,3-7H2,1-2H3,(H,11,13)/t8-,15?/m0/s1 |
| InChIKey | WJBVFSQDYVEXJP-CYQMCQFNSA-N |
| XLogP | 0.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-ethyl-8-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-ethyl-8-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one?
The IUPAC name of (2S)-2-ethyl-8-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one (CID 10014086) is (2S)-2-ethyl-8-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one.
What is the SMILES notation for (2S)-2-ethyl-8-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one?
The canonical SMILES for (2S)-2-ethyl-8-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one is CC[C@H]1C(=O)NC2(CCN(C)CC2)S1=O.
What is the InChIKey of (2S)-2-ethyl-8-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one?
The InChIKey is WJBVFSQDYVEXJP-CYQMCQFNSA-N. The full InChI is InChI=1S/C10H18N2O2S/c1-3-8-9(13)11-10(15(8)14)4-6-12(2)7-5-10/h8H,3-7H2,1-2H3,(H,11,13)/t8-,15?/m0/s1.
What are the key properties of (2S)-2-ethyl-8-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one?
(2S)-2-ethyl-8-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one has a molecular weight of 230.33 g/mol, XLogP of 0.07, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-ethyl-8-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one is sourced from PubChem (CID 10014086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).