C15H24O2 — CID 10014361
(3aR,3bR,6aS,7R,7aR)-7-methoxy-3a,3b,7a-trimethyl-2,3,4,6,6a,7-hexahydro-1H-cyclopenta[a]pentalen-5-one (PubChem CID 10014361) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (3aR,3bR,6aS,7R,7aR)-7-methoxy-3a,3b,7a-trimethyl-2,3,4,6,6a,7-hexahydro-1H-cyclopenta[a]pentalen-5-one.
| Compound Name | (3aR,3bR,6aS,7R,7aR)-7-methoxy-3a,3b,7a-trimethyl-2,3,4,6,6a,7-hexahydro-1H-cyclopenta[a]pentalen-5-one |
|---|---|
| PubChem CID | 10014361 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (3aR,3bR,6aS,7R,7aR)-7-methoxy-3a,3b,7a-trimethyl-2,3,4,6,6a,7-hexahydro-1H-cyclopenta[a]pentalen-5-one |
| SMILES | CO[C@@H]1[C@H]2CC(=O)C[C@@]2(C)[C@@]2(C)CCC[C@@]12C |
| InChI | InChI=1S/C15H24O2/c1-13-6-5-7-15(13,3)14(2)9-10(16)8-11(14)12(13)17-4/h11-12H,5-9H2,1-4H3/t11-,12-,13+,14-,15+/m1/s1 |
| InChIKey | UMLXJCMJZHCHDY-QMIVOQANSA-N |
| XLogP | 3.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |