C14H22O3 — CID 10014443
(3R,3aS,8S,8aS)-3,8-dimethylspiro[1,3,3a,5,6,7,8,8a-octahydroazulene-2,2'-1,3-dioxolane]-4-one (PubChem CID 10014443) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is (3R,3aS,8S,8aS)-3,8-dimethylspiro[1,3,3a,5,6,7,8,8a-octahydroazulene-2,2'-1,3-dioxolane]-4-one.
| Compound Name | (3R,3aS,8S,8aS)-3,8-dimethylspiro[1,3,3a,5,6,7,8,8a-octahydroazulene-2,2'-1,3-dioxolane]-4-one |
|---|---|
| PubChem CID | 10014443 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (3R,3aS,8S,8aS)-3,8-dimethylspiro[1,3,3a,5,6,7,8,8a-octahydroazulene-2,2'-1,3-dioxolane]-4-one |
| SMILES | C[C@@H]1[C@H]2C(=O)CCC[C@H](C)[C@@H]2CC12OCCO2 |
| InChI | InChI=1S/C14H22O3/c1-9-4-3-5-12(15)13-10(2)14(8-11(9)13)16-6-7-17-14/h9-11,13H,3-8H2,1-2H3/t9-,10+,11-,13+/m0/s1 |
| InChIKey | SVOWPHLOZCSJMY-SRRSOLGSSA-N |
| XLogP | 2.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |