C15H26O2 — CID 10014455
tert-butyl (1R,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate (PubChem CID 10014455) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is tert-butyl (1R,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate.
| Compound Name | tert-butyl (1R,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 10014455 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | tert-butyl (1R,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCCC2CCCC[C@H]21 |
| InChI | InChI=1S/C15H26O2/c1-15(2,3)17-14(16)13-10-6-8-11-7-4-5-9-12(11)13/h11-13H,4-10H2,1-3H3/t11?,12-,13-/m1/s1 |
| InChIKey | BTLRQQILTCCHCI-VFRRUGBOSA-N |
| XLogP | 3.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |