About 3-amino-5-(3,5-dimethylpyrazol-1-yl)pyrazine-2,6-dicarbonitrile
3-amino-5-(3,5-dimethylpyrazol-1-yl)pyrazine-2,6-dicarbonitrile (PubChem CID 10014474) has the molecular formula C11H9N7
and a molecular weight of 239.24 g/mol. Its IUPAC name is 3-amino-5-(3,5-dimethylpyrazol-1-yl)pyrazine-2,6-dicarbonitrile.
Molecular Properties
| Compound Name | 3-amino-5-(3,5-dimethylpyrazol-1-yl)pyrazine-2,6-dicarbonitrile |
| PubChem CID | 10014474 |
| Molecular Formula | C11H9N7 |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 3-amino-5-(3,5-dimethylpyrazol-1-yl)pyrazine-2,6-dicarbonitrile |
| SMILES | Cc1cc(C)n(-c2nc(N)c(C#N)nc2C#N)n1 |
| InChI | InChI=1S/C11H9N7/c1-6-3-7(2)18(17-6)11-9(5-13)15-8(4-12)10(14)16-11/h3H,1-2H3,(H2,14,16) |
| InChIKey | LDFATDJGVGLISE-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-amino-5-(3,5-dimethylpyrazol-1-yl)pyrazine-2,6-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-(3,5-dimethylpyrazol-1-yl)pyrazine-2,6-dicarbonitrile?
The IUPAC name of 3-amino-5-(3,5-dimethylpyrazol-1-yl)pyrazine-2,6-dicarbonitrile (CID 10014474) is 3-amino-5-(3,5-dimethylpyrazol-1-yl)pyrazine-2,6-dicarbonitrile.
What is the SMILES notation for 3-amino-5-(3,5-dimethylpyrazol-1-yl)pyrazine-2,6-dicarbonitrile?
The canonical SMILES for 3-amino-5-(3,5-dimethylpyrazol-1-yl)pyrazine-2,6-dicarbonitrile is Cc1cc(C)n(-c2nc(N)c(C#N)nc2C#N)n1.
What is the InChIKey of 3-amino-5-(3,5-dimethylpyrazol-1-yl)pyrazine-2,6-dicarbonitrile?
The InChIKey is LDFATDJGVGLISE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N7/c1-6-3-7(2)18(17-6)11-9(5-13)15-8(4-12)10(14)16-11/h3H,1-2H3,(H2,14,16).
What are the key properties of 3-amino-5-(3,5-dimethylpyrazol-1-yl)pyrazine-2,6-dicarbonitrile?
3-amino-5-(3,5-dimethylpyrazol-1-yl)pyrazine-2,6-dicarbonitrile has a molecular weight of 239.24 g/mol, XLogP of 0.60, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-(3,5-dimethylpyrazol-1-yl)pyrazine-2,6-dicarbonitrile is sourced from PubChem (CID 10014474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).