C11H21NOS2 — CID 10014875
(NE)-N-[1-(2-methyl-1,3-dithiolan-2-yl)heptan-3-ylidene]hydroxylamine (PubChem CID 10014875) has the molecular formula C11H21NOS2 and a molecular weight of 247.43 g/mol. Its IUPAC name is (NE)-N-[1-(2-methyl-1,3-dithiolan-2-yl)heptan-3-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-(2-methyl-1,3-dithiolan-2-yl)heptan-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 10014875 |
| Molecular Formula | C11H21NOS2 |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | (NE)-N-[1-(2-methyl-1,3-dithiolan-2-yl)heptan-3-ylidene]hydroxylamine |
| SMILES | CCCC/C(CCC1(C)SCCS1)=N\O |
| InChI | InChI=1S/C11H21NOS2/c1-3-4-5-10(12-13)6-7-11(2)14-8-9-15-11/h13H,3-9H2,1-2H3/b12-10+ |
| InChIKey | GBMANQITFXCLGP-ZRDIBKRKSA-N |
| XLogP | 3.98 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|