C7H3F7O2 — CID 10015064
2-(1,1,2,2,3,3,3-heptafluoropropyl)-2H-furan-5-one (PubChem CID 10015064) has the molecular formula C7H3F7O2 and a molecular weight of 252.09 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropyl)-2H-furan-5-one.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-2H-furan-5-one |
|---|---|
| PubChem CID | 10015064 |
| Molecular Formula | C7H3F7O2 |
| Molecular Weight | 252.09 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-2H-furan-5-one |
| SMILES | O=C1C=CC(C(F)(F)C(F)(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C7H3F7O2/c8-5(9,3-1-2-4(15)16-3)6(10,11)7(12,13)14/h1-3H |
| InChIKey | CNLNFEHEUBCQRA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.09 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|