About tert-butyl-[(Z)-2,6-dimethylhept-3-en-4-yl]oxy-dimethylsilane
tert-butyl-[(Z)-2,6-dimethylhept-3-en-4-yl]oxy-dimethylsilane (PubChem CID 10015302) has the molecular formula C15H32OSi
and a molecular weight of 256.51 g/mol. Its IUPAC name is tert-butyl-[(Z)-2,6-dimethylhept-3-en-4-yl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(Z)-2,6-dimethylhept-3-en-4-yl]oxy-dimethylsilane |
| PubChem CID | 10015302 |
| Molecular Formula | C15H32OSi |
| Molecular Weight | 256.51 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | tert-butyl-[(Z)-2,6-dimethylhept-3-en-4-yl]oxy-dimethylsilane |
| SMILES | CC(C)/C=C(/CC(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H32OSi/c1-12(2)10-14(11-13(3)4)16-17(8,9)15(5,6)7/h10,12-13H,11H2,1-9H3/b14-10- |
| InChIKey | IQXMSOYOCVDFSB-UVTDQMKNSA-N |
| XLogP | 5.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(Z)-2,6-dimethylhept-3-en-4-yl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(Z)-2,6-dimethylhept-3-en-4-yl]oxy-dimethylsilane?
The IUPAC name of tert-butyl-[(Z)-2,6-dimethylhept-3-en-4-yl]oxy-dimethylsilane (CID 10015302) is tert-butyl-[(Z)-2,6-dimethylhept-3-en-4-yl]oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-[(Z)-2,6-dimethylhept-3-en-4-yl]oxy-dimethylsilane?
The canonical SMILES for tert-butyl-[(Z)-2,6-dimethylhept-3-en-4-yl]oxy-dimethylsilane is CC(C)/C=C(/CC(C)C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-[(Z)-2,6-dimethylhept-3-en-4-yl]oxy-dimethylsilane?
The InChIKey is IQXMSOYOCVDFSB-UVTDQMKNSA-N. The full InChI is InChI=1S/C15H32OSi/c1-12(2)10-14(11-13(3)4)16-17(8,9)15(5,6)7/h10,12-13H,11H2,1-9H3/b14-10-.
What are the key properties of tert-butyl-[(Z)-2,6-dimethylhept-3-en-4-yl]oxy-dimethylsilane?
tert-butyl-[(Z)-2,6-dimethylhept-3-en-4-yl]oxy-dimethylsilane has a molecular weight of 256.51 g/mol, XLogP of 5.59, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(Z)-2,6-dimethylhept-3-en-4-yl]oxy-dimethylsilane is sourced from PubChem (CID 10015302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).