C16H18O3 — CID 10015379
7-methoxy-3,8-dimethyl-5-propan-2-ylnaphthalene-1,2-dione (PubChem CID 10015379) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 7-methoxy-3,8-dimethyl-5-propan-2-ylnaphthalene-1,2-dione.
| Compound Name | 7-methoxy-3,8-dimethyl-5-propan-2-ylnaphthalene-1,2-dione |
|---|---|
| PubChem CID | 10015379 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 7-methoxy-3,8-dimethyl-5-propan-2-ylnaphthalene-1,2-dione |
| SMILES | COc1cc(C(C)C)c2c(c1C)C(=O)C(=O)C(C)=C2 |
| InChI | InChI=1S/C16H18O3/c1-8(2)11-7-13(19-5)10(4)14-12(11)6-9(3)15(17)16(14)18/h6-8H,1-5H3 |
| InChIKey | OXLUVZLYDTVKFU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|