C11H16O7 — CID 10015451
trimethyl (Z,3R)-3-hydroxy-1-methylbut-1-ene-1,2,4-tricarboxylate (PubChem CID 10015451) has the molecular formula C11H16O7 and a molecular weight of 260.24 g/mol. Its IUPAC name is trimethyl (Z,3R)-3-hydroxy-1-methylbut-1-ene-1,2,4-tricarboxylate.
| Compound Name | trimethyl (Z,3R)-3-hydroxy-1-methylbut-1-ene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 10015451 |
| Molecular Formula | C11H16O7 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | trimethyl (Z,3R)-3-hydroxy-1-methylbut-1-ene-1,2,4-tricarboxylate |
| SMILES | COC(=O)C[C@@H](O)/C(C(=O)OC)=C(\C)C(=O)OC |
| InChI | InChI=1S/C11H16O7/c1-6(10(14)17-3)9(11(15)18-4)7(12)5-8(13)16-2/h7,12H,5H2,1-4H3/b9-6-/t7-/m1/s1 |
| InChIKey | ZOGCQMNUKAVHCT-WRDFDADTSA-N |
| XLogP | -0.43 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|