C15H19NO3 — CID 10015520
N-benzyl-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine oxide (PubChem CID 10015520) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is N-benzyl-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine oxide.
| Compound Name | N-benzyl-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine oxide |
|---|---|
| PubChem CID | 10015520 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | N-benzyl-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine oxide |
| SMILES | C=C[C@H]1OC(C)(C)O[C@H]1/C=[N+](/[O-])Cc1ccccc1 |
| InChI | InChI=1S/C15H19NO3/c1-4-13-14(19-15(2,3)18-13)11-16(17)10-12-8-6-5-7-9-12/h4-9,11,13-14H,1,10H2,2-3H3/b16-11+/t13-,14+/m1/s1 |
| InChIKey | KQSUANIJNSQVTB-WAWJYGGWSA-N |
| XLogP | 2.47 |
| TPSA | 44.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|