C16H22O3 — CID 10015580
methyl (4aR,4bS,8aS,10aR)-2-oxo-1,3,4,4b,5,6,8a,9,10,10a-decahydrophenanthrene-4a-carboxylate (PubChem CID 10015580) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is methyl (4aR,4bS,8aS,10aR)-2-oxo-1,3,4,4b,5,6,8a,9,10,10a-decahydrophenanthrene-4a-carboxylate.
| Compound Name | methyl (4aR,4bS,8aS,10aR)-2-oxo-1,3,4,4b,5,6,8a,9,10,10a-decahydrophenanthrene-4a-carboxylate |
|---|---|
| PubChem CID | 10015580 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | methyl (4aR,4bS,8aS,10aR)-2-oxo-1,3,4,4b,5,6,8a,9,10,10a-decahydrophenanthrene-4a-carboxylate |
| SMILES | COC(=O)[C@]12CCC(=O)C[C@H]1CC[C@H]1C=CCC[C@@H]12 |
| InChI | InChI=1S/C16H22O3/c1-19-15(18)16-9-8-13(17)10-12(16)7-6-11-4-2-3-5-14(11)16/h2,4,11-12,14H,3,5-10H2,1H3/t11-,12-,14+,16-/m1/s1 |
| InChIKey | NOGAXFVTKXIVLW-UNIGVISCSA-N |
| XLogP | 2.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|