C17H12O3 — CID 10015652
3,13-dioxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaen-4-ylmethanol (PubChem CID 10015652) has the molecular formula C17H12O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 3,13-dioxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaen-4-ylmethanol.
| Compound Name | 3,13-dioxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaen-4-ylmethanol |
|---|---|
| PubChem CID | 10015652 |
| Molecular Formula | C17H12O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 3,13-dioxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaen-4-ylmethanol |
| SMILES | OCc1cc2c(o1)-c1ccccc1Oc1ccccc1-2 |
| InChI | InChI=1S/C17H12O3/c18-10-11-9-14-12-5-1-3-7-15(12)20-16-8-4-2-6-13(16)17(14)19-11/h1-9,18H,10H2 |
| InChIKey | AYDWNSJCXKHELQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |