C15H20O4 — CID 10015667
(1R,2S,6R,7S,8R)-6-(hydroxymethyl)-2,6,7-trimethyl-9-oxatricyclo[6.3.1.01,5]dodec-4-ene-3,10-dione (PubChem CID 10015667) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (1R,2S,6R,7S,8R)-6-(hydroxymethyl)-2,6,7-trimethyl-9-oxatricyclo[6.3.1.01,5]dodec-4-ene-3,10-dione.
| Compound Name | (1R,2S,6R,7S,8R)-6-(hydroxymethyl)-2,6,7-trimethyl-9-oxatricyclo[6.3.1.01,5]dodec-4-ene-3,10-dione |
|---|---|
| PubChem CID | 10015667 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (1R,2S,6R,7S,8R)-6-(hydroxymethyl)-2,6,7-trimethyl-9-oxatricyclo[6.3.1.01,5]dodec-4-ene-3,10-dione |
| SMILES | C[C@@H]1C(=O)C=C2[C@]13CC(=O)O[C@H](C3)[C@@H](C)[C@@]2(C)CO |
| InChI | InChI=1S/C15H20O4/c1-8-10(17)4-12-14(3,7-16)9(2)11-5-15(8,12)6-13(18)19-11/h4,8-9,11,16H,5-7H2,1-3H3/t8-,9-,11-,14-,15-/m1/s1 |
| InChIKey | OZYHJADBOXHPLS-LVSZHXFLSA-N |
| XLogP | 1.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |