About 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-5-trimethylsilylfuran-3-carbaldehyde
2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-5-trimethylsilylfuran-3-carbaldehyde (PubChem CID 10015733) has the molecular formula C13H19NO3Si
and a molecular weight of 265.38 g/mol. Its IUPAC name is 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-5-trimethylsilylfuran-3-carbaldehyde.
Molecular Properties
| Compound Name | 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-5-trimethylsilylfuran-3-carbaldehyde |
| PubChem CID | 10015733 |
| Molecular Formula | C13H19NO3Si |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-5-trimethylsilylfuran-3-carbaldehyde |
| SMILES | CC1(C)COC(c2oc([Si](C)(C)C)cc2C=O)=N1 |
| InChI | InChI=1S/C13H19NO3Si/c1-13(2)8-16-12(14-13)11-9(7-15)6-10(17-11)18(3,4)5/h6-7H,8H2,1-5H3 |
| InChIKey | PFXMOHQRFRYXHZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-5-trimethylsilylfuran-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-5-trimethylsilylfuran-3-carbaldehyde?
The IUPAC name of 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-5-trimethylsilylfuran-3-carbaldehyde (CID 10015733) is 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-5-trimethylsilylfuran-3-carbaldehyde.
What is the SMILES notation for 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-5-trimethylsilylfuran-3-carbaldehyde?
The canonical SMILES for 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-5-trimethylsilylfuran-3-carbaldehyde is CC1(C)COC(c2oc([Si](C)(C)C)cc2C=O)=N1.
What is the InChIKey of 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-5-trimethylsilylfuran-3-carbaldehyde?
The InChIKey is PFXMOHQRFRYXHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO3Si/c1-13(2)8-16-12(14-13)11-9(7-15)6-10(17-11)18(3,4)5/h6-7H,8H2,1-5H3.
What are the key properties of 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-5-trimethylsilylfuran-3-carbaldehyde?
2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-5-trimethylsilylfuran-3-carbaldehyde has a molecular weight of 265.38 g/mol, XLogP of 2.19, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-5-trimethylsilylfuran-3-carbaldehyde is sourced from PubChem (CID 10015733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).