About 4-iodo-3,5-dimethoxy-1-methylpyrazole
4-iodo-3,5-dimethoxy-1-methylpyrazole (PubChem CID 10015835) has the molecular formula C6H9IN2O2
and a molecular weight of 268.05 g/mol. Its IUPAC name is 4-iodo-3,5-dimethoxy-1-methylpyrazole.
Molecular Properties
| Compound Name | 4-iodo-3,5-dimethoxy-1-methylpyrazole |
| PubChem CID | 10015835 |
| Molecular Formula | C6H9IN2O2 |
| Molecular Weight | 268.05 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 4-iodo-3,5-dimethoxy-1-methylpyrazole |
| SMILES | COc1nn(C)c(OC)c1I |
| InChI | InChI=1S/C6H9IN2O2/c1-9-6(11-3)4(7)5(8-9)10-2/h1-3H3 |
| InChIKey | SBTVECPETSKQOT-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.05 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodo-3,5-dimethoxy-1-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodo-3,5-dimethoxy-1-methylpyrazole?
The IUPAC name of 4-iodo-3,5-dimethoxy-1-methylpyrazole (CID 10015835) is 4-iodo-3,5-dimethoxy-1-methylpyrazole.
What is the SMILES notation for 4-iodo-3,5-dimethoxy-1-methylpyrazole?
The canonical SMILES for 4-iodo-3,5-dimethoxy-1-methylpyrazole is COc1nn(C)c(OC)c1I.
What is the InChIKey of 4-iodo-3,5-dimethoxy-1-methylpyrazole?
The InChIKey is SBTVECPETSKQOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9IN2O2/c1-9-6(11-3)4(7)5(8-9)10-2/h1-3H3.
What are the key properties of 4-iodo-3,5-dimethoxy-1-methylpyrazole?
4-iodo-3,5-dimethoxy-1-methylpyrazole has a molecular weight of 268.05 g/mol, XLogP of 1.04, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodo-3,5-dimethoxy-1-methylpyrazole is sourced from PubChem (CID 10015835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).