C17H22N2O — CID 10015980
8-[methyl(propyl)amino]-6,7,8,9-tetrahydro-3H-benzo[e]indole-1-carbaldehyde (PubChem CID 10015980) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 8-[methyl(propyl)amino]-6,7,8,9-tetrahydro-3H-benzo[e]indole-1-carbaldehyde.
| Compound Name | 8-[methyl(propyl)amino]-6,7,8,9-tetrahydro-3H-benzo[e]indole-1-carbaldehyde |
|---|---|
| PubChem CID | 10015980 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 8-[methyl(propyl)amino]-6,7,8,9-tetrahydro-3H-benzo[e]indole-1-carbaldehyde |
| SMILES | CCCN(C)C1CCc2ccc3[nH]cc(C=O)c3c2C1 |
| InChI | InChI=1S/C17H22N2O/c1-3-8-19(2)14-6-4-12-5-7-16-17(15(12)9-14)13(11-20)10-18-16/h5,7,10-11,14,18H,3-4,6,8-9H2,1-2H3 |
| InChIKey | LJZGVNXOVBOMKA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|