C17H20O3 — CID 10016076
(8E,10E,12E,14R)-14-hydroxyheptadeca-8,10,12-trien-4,6-diynoic acid (PubChem CID 10016076) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is (8E,10E,12E,14R)-14-hydroxyheptadeca-8,10,12-trien-4,6-diynoic acid.
| Compound Name | (8E,10E,12E,14R)-14-hydroxyheptadeca-8,10,12-trien-4,6-diynoic acid |
|---|---|
| PubChem CID | 10016076 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (8E,10E,12E,14R)-14-hydroxyheptadeca-8,10,12-trien-4,6-diynoic acid |
| SMILES | CCC[C@@H](O)/C=C/C=C/C=C/C#CC#CCCC(=O)O |
| InChI | InChI=1S/C17H20O3/c1-2-13-16(18)14-11-9-7-5-3-4-6-8-10-12-15-17(19)20/h3,5,7,9,11,14,16,18H,2,12-13,15H2,1H3,(H,19,20)/b5-3+,9-7+,14-11+/t16-/m1/s1 |
| InChIKey | DGSGPZQBYHSNDL-VMEUEADTSA-N |
| XLogP | 2.69 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|