C21H18BrNO — CID 1001609
N-(2-bromo-4-methylphenyl)-2,2-diphenylacetamide (PubChem CID 1001609) has the molecular formula C21H18BrNO and a molecular weight of 380.29 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-2,2-diphenylacetamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 1001609 |
| Molecular Formula | C21H18BrNO |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-2,2-diphenylacetamide |
| SMILES | Cc1ccc(NC(=O)C(c2ccccc2)c2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C21H18BrNO/c1-15-12-13-19(18(22)14-15)23-21(24)20(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-14,20H,1H3,(H,23,24) |
| InChIKey | QJBUQOJXOYYGHE-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |