C11H17BrO3 — CID 10016335
(3E,4S,5S)-3-(bromomethylidene)-4-(hydroxymethyl)-5-pentyloxolan-2-one (PubChem CID 10016335) has the molecular formula C11H17BrO3 and a molecular weight of 277.16 g/mol. Its IUPAC name is (3E,4S,5S)-3-(bromomethylidene)-4-(hydroxymethyl)-5-pentyloxolan-2-one.
| Compound Name | (3E,4S,5S)-3-(bromomethylidene)-4-(hydroxymethyl)-5-pentyloxolan-2-one |
|---|---|
| PubChem CID | 10016335 |
| Molecular Formula | C11H17BrO3 |
| Molecular Weight | 277.16 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | (3E,4S,5S)-3-(bromomethylidene)-4-(hydroxymethyl)-5-pentyloxolan-2-one |
| SMILES | CCCCC[C@@H]1OC(=O)/C(=C/Br)[C@H]1CO |
| InChI | InChI=1S/C11H17BrO3/c1-2-3-4-5-10-9(7-13)8(6-12)11(14)15-10/h6,9-10,13H,2-5,7H2,1H3/b8-6+/t9-,10+/m1/s1 |
| InChIKey | GZURNPZXDLBICU-ZQMPTTJKSA-N |
| XLogP | 2.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.16 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|