C11H18O3Se — CID 10016338
(1R,2S,4R,5S)-4-(methoxymethyl)-2,5-dimethyl-8-oxa-3-selenabicyclo[3.2.1]octane-2-carbaldehyde (PubChem CID 10016338) has the molecular formula C11H18O3Se and a molecular weight of 277.22 g/mol. Its IUPAC name is (1R,2S,4R,5S)-4-(methoxymethyl)-2,5-dimethyl-8-oxa-3-selenabicyclo[3.2.1]octane-2-carbaldehyde.
| Compound Name | (1R,2S,4R,5S)-4-(methoxymethyl)-2,5-dimethyl-8-oxa-3-selenabicyclo[3.2.1]octane-2-carbaldehyde |
|---|---|
| PubChem CID | 10016338 |
| Molecular Formula | C11H18O3Se |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | (1R,2S,4R,5S)-4-(methoxymethyl)-2,5-dimethyl-8-oxa-3-selenabicyclo[3.2.1]octane-2-carbaldehyde |
| SMILES | COC[C@H]1[Se][C@](C)(C=O)[C@H]2CC[C@]1(C)O2 |
| InChI | InChI=1S/C11H18O3Se/c1-10-5-4-8(14-10)11(2,7-12)15-9(10)6-13-3/h7-9H,4-6H2,1-3H3/t8-,9-,10+,11-/m1/s1 |
| InChIKey | DTTRCAMJQGJPSC-CHWFTXMASA-N |
| XLogP | 1.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|