C14H22F3NO — CID 10016351
N-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,2,2-trifluoro-N-methylacetamide (PubChem CID 10016351) has the molecular formula C14H22F3NO and a molecular weight of 277.33 g/mol. Its IUPAC name is N-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,2,2-trifluoro-N-methylacetamide.
| Compound Name | N-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,2,2-trifluoro-N-methylacetamide |
|---|---|
| PubChem CID | 10016351 |
| Molecular Formula | C14H22F3NO |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | N-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,2,2-trifluoro-N-methylacetamide |
| SMILES | CC(C)=CCC/C(C)=C/CCN(C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C14H22F3NO/c1-11(2)7-5-8-12(3)9-6-10-18(4)13(19)14(15,16)17/h7,9H,5-6,8,10H2,1-4H3/b12-9+ |
| InChIKey | JLLRMHXQBSATMI-FMIVXFBMSA-N |
| XLogP | 4.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|