About 2-(4-chlorophenyl)-N-(3,3-diphenylpropyl)acetamide
2-(4-chlorophenyl)-N-(3,3-diphenylpropyl)acetamide (PubChem CID 1001644) has the molecular formula C23H22ClNO
and a molecular weight of 363.89 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(3,3-diphenylpropyl)acetamide.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-N-(3,3-diphenylpropyl)acetamide |
| PubChem CID | 1001644 |
| Molecular Formula | C23H22ClNO |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(3,3-diphenylpropyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22ClNO/c24-21-13-11-18(12-14-21)17-23(26)25-16-15-22(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-14,22H,15-17H2,(H,25,26) |
| InChIKey | MFACDIQCEXNDKV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-chlorophenyl)-N-(3,3-diphenylpropyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-N-(3,3-diphenylpropyl)acetamide?
The IUPAC name of 2-(4-chlorophenyl)-N-(3,3-diphenylpropyl)acetamide (CID 1001644) is 2-(4-chlorophenyl)-N-(3,3-diphenylpropyl)acetamide.
What is the SMILES notation for 2-(4-chlorophenyl)-N-(3,3-diphenylpropyl)acetamide?
The canonical SMILES for 2-(4-chlorophenyl)-N-(3,3-diphenylpropyl)acetamide is O=C(Cc1ccc(Cl)cc1)NCCC(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(4-chlorophenyl)-N-(3,3-diphenylpropyl)acetamide?
The InChIKey is MFACDIQCEXNDKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22ClNO/c24-21-13-11-18(12-14-21)17-23(26)25-16-15-22(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-14,22H,15-17H2,(H,25,26).
What are the key properties of 2-(4-chlorophenyl)-N-(3,3-diphenylpropyl)acetamide?
2-(4-chlorophenyl)-N-(3,3-diphenylpropyl)acetamide has a molecular weight of 363.89 g/mol, XLogP of 5.22, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-N-(3,3-diphenylpropyl)acetamide is sourced from PubChem (CID 1001644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).