C16H24O4 — CID 10016520
methyl (1S,4R,5S,8R)-4,7,7-trimethyl-10-oxo-12-oxatricyclo[6.3.1.01,5]dodecane-9-carboxylate (PubChem CID 10016520) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is methyl (1S,4R,5S,8R)-4,7,7-trimethyl-10-oxo-12-oxatricyclo[6.3.1.01,5]dodecane-9-carboxylate.
| Compound Name | methyl (1S,4R,5S,8R)-4,7,7-trimethyl-10-oxo-12-oxatricyclo[6.3.1.01,5]dodecane-9-carboxylate |
|---|---|
| PubChem CID | 10016520 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | methyl (1S,4R,5S,8R)-4,7,7-trimethyl-10-oxo-12-oxatricyclo[6.3.1.01,5]dodecane-9-carboxylate |
| SMILES | COC(=O)C1C(=O)C[C@@]23CC[C@@H](C)[C@@H]2CC(C)(C)[C@@H]1O3 |
| InChI | InChI=1S/C16H24O4/c1-9-5-6-16-8-11(17)12(14(18)19-4)13(20-16)15(2,3)7-10(9)16/h9-10,12-13H,5-8H2,1-4H3/t9-,10+,12?,13-,16+/m1/s1 |
| InChIKey | ZSLYZHDFDXTBIO-BMMRSJIRSA-N |
| XLogP | 2.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|