C16H31NOSi — CID 10016594
tert-butyl-[[(1R,2R,3S,5S)-2-ethenyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-dimethylsilane (PubChem CID 10016594) has the molecular formula C16H31NOSi and a molecular weight of 281.52 g/mol. Its IUPAC name is tert-butyl-[[(1R,2R,3S,5S)-2-ethenyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,2R,3S,5S)-2-ethenyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 10016594 |
| Molecular Formula | C16H31NOSi |
| Molecular Weight | 281.52 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | tert-butyl-[[(1R,2R,3S,5S)-2-ethenyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-dimethylsilane |
| SMILES | C=C[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]2CC[C@H]1N2C |
| InChI | InChI=1S/C16H31NOSi/c1-8-13-14-10-9-12(17(14)5)11-15(13)18-19(6,7)16(2,3)4/h8,12-15H,1,9-11H2,2-7H3/t12-,13+,14+,15-/m0/s1 |
| InChIKey | HYEKOJYAJOCPRM-YJNKXOJESA-N |
| XLogP | 4.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|