C18H21NO2 — CID 10016689
4,5-dimethoxy-9-methyl-9-azatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene (PubChem CID 10016689) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 4,5-dimethoxy-9-methyl-9-azatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene.
| Compound Name | 4,5-dimethoxy-9-methyl-9-azatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene |
|---|---|
| PubChem CID | 10016689 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 4,5-dimethoxy-9-methyl-9-azatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene |
| SMILES | COc1cc2c(cc1OC)-c1ccccc1CCN(C)C2 |
| InChI | InChI=1S/C18H21NO2/c1-19-9-8-13-6-4-5-7-15(13)16-11-18(21-3)17(20-2)10-14(16)12-19/h4-7,10-11H,8-9,12H2,1-3H3 |
| InChIKey | GETRAQVOIHRJTE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |