C18H20O3 — CID 10016731
6-ethyl-4,7,10-trimethyl-6H-benzo[c]chromene-3,8-diol (PubChem CID 10016731) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is 6-ethyl-4,7,10-trimethyl-6H-benzo[c]chromene-3,8-diol.
| Compound Name | 6-ethyl-4,7,10-trimethyl-6H-benzo[c]chromene-3,8-diol |
|---|---|
| PubChem CID | 10016731 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 6-ethyl-4,7,10-trimethyl-6H-benzo[c]chromene-3,8-diol |
| SMILES | CCC1Oc2c(ccc(O)c2C)-c2c(C)cc(O)c(C)c21 |
| InChI | InChI=1S/C18H20O3/c1-5-15-17-10(3)14(20)8-9(2)16(17)12-6-7-13(19)11(4)18(12)21-15/h6-8,15,19-20H,5H2,1-4H3 |
| InChIKey | VIDLZOFQQMUWMT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |