C18H23NO2 — CID 10016797
3-[(3R,4R)-1-(furan-3-ylmethyl)-3,4-dimethylpiperidin-4-yl]phenol (PubChem CID 10016797) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-[(3R,4R)-1-(furan-3-ylmethyl)-3,4-dimethylpiperidin-4-yl]phenol.
| Compound Name | 3-[(3R,4R)-1-(furan-3-ylmethyl)-3,4-dimethylpiperidin-4-yl]phenol |
|---|---|
| PubChem CID | 10016797 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 3-[(3R,4R)-1-(furan-3-ylmethyl)-3,4-dimethylpiperidin-4-yl]phenol |
| SMILES | C[C@H]1CN(Cc2ccoc2)CC[C@@]1(C)c1cccc(O)c1 |
| InChI | InChI=1S/C18H23NO2/c1-14-11-19(12-15-6-9-21-13-15)8-7-18(14,2)16-4-3-5-17(20)10-16/h3-6,9-10,13-14,20H,7-8,11-12H2,1-2H3/t14-,18+/m0/s1 |
| InChIKey | LNJUVFLSOJKZMF-KBXCAEBGSA-N |
| XLogP | 3.78 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |