C16H14O5 — CID 10016827
(1S,4Z,13S,14S)-5-methyl-15,17-dioxatetracyclo[11.2.2.01,14.07,12]heptadeca-4,7(12),9-triene-8,11,16-trione (PubChem CID 10016827) has the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. Its IUPAC name is (1S,4Z,13S,14S)-5-methyl-15,17-dioxatetracyclo[11.2.2.01,14.07,12]heptadeca-4,7(12),9-triene-8,11,16-trione.
| Compound Name | (1S,4Z,13S,14S)-5-methyl-15,17-dioxatetracyclo[11.2.2.01,14.07,12]heptadeca-4,7(12),9-triene-8,11,16-trione |
|---|---|
| PubChem CID | 10016827 |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | (1S,4Z,13S,14S)-5-methyl-15,17-dioxatetracyclo[11.2.2.01,14.07,12]heptadeca-4,7(12),9-triene-8,11,16-trione |
| SMILES | C/C1=C\CC[C@]23O[C@H]2[C@@H](OC3=O)C2=C(C1)C(=O)C=CC2=O |
| InChI | InChI=1S/C16H14O5/c1-8-3-2-6-16-14(21-16)13(20-15(16)19)12-9(7-8)10(17)4-5-11(12)18/h3-5,13-14H,2,6-7H2,1H3/b8-3+/t13-,14-,16-/m0/s1 |
| InChIKey | YRXDNWATDIWPIX-BYJRLFCCSA-N |
| XLogP | 1.18 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|