butan-2-yl 2-(6-methoxynaphthalen-2-yl)propanoate

C18H22O3 — CID 10016853

IUPACbutan-2-yl 2-(6-methoxynaphthalen-2-yl)propanoate
SMILESCCC(C)OC(=O)C(C)c1ccc2cc(OC)ccc2c1
InChIInChI=1S/C18H22O3/c1-5-12(2)21-18(19)13(3)14-6-7-16-11-17(20-4)9-8-15(16)10-14/h6-13H,5H2,1-4H3
InChIKeyFLAKSIKQQCWURS-UHFFFAOYSA-N
MW286.37 g/mol
LogP4.29
Rot. Bonds5

About butan-2-yl 2-(6-methoxynaphthalen-2-yl)propanoate

butan-2-yl 2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 10016853) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is butan-2-yl 2-(6-methoxynaphthalen-2-yl)propanoate.

Molecular Properties

Compound Namebutan-2-yl 2-(6-methoxynaphthalen-2-yl)propanoate
PubChem CID10016853
Molecular FormulaC18H22O3
Molecular Weight286.37 g/mol
Exact Mass286.16
IUPAC Namebutan-2-yl 2-(6-methoxynaphthalen-2-yl)propanoate
SMILESCCC(C)OC(=O)C(C)c1ccc2cc(OC)ccc2c1
InChIInChI=1S/C18H22O3/c1-5-12(2)21-18(19)13(3)14-6-7-16-11-17(20-4)9-8-15(16)10-14/h6-13H,5H2,1-4H3
InChIKeyFLAKSIKQQCWURS-UHFFFAOYSA-N
XLogP4.29
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.37
LogP ≤ 54.29
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze butan-2-yl 2-(6-methoxynaphthalen-2-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butan-2-yl 2-(6-methoxynaphthalen-2-yl)propanoate?
The IUPAC name of butan-2-yl 2-(6-methoxynaphthalen-2-yl)propanoate (CID 10016853) is butan-2-yl 2-(6-methoxynaphthalen-2-yl)propanoate.
What is the SMILES notation for butan-2-yl 2-(6-methoxynaphthalen-2-yl)propanoate?
The canonical SMILES for butan-2-yl 2-(6-methoxynaphthalen-2-yl)propanoate is CCC(C)OC(=O)C(C)c1ccc2cc(OC)ccc2c1.
What is the InChIKey of butan-2-yl 2-(6-methoxynaphthalen-2-yl)propanoate?
The InChIKey is FLAKSIKQQCWURS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O3/c1-5-12(2)21-18(19)13(3)14-6-7-16-11-17(20-4)9-8-15(16)10-14/h6-13H,5H2,1-4H3.
What are the key properties of butan-2-yl 2-(6-methoxynaphthalen-2-yl)propanoate?
butan-2-yl 2-(6-methoxynaphthalen-2-yl)propanoate has a molecular weight of 286.37 g/mol, XLogP of 4.29, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl 2-(6-methoxynaphthalen-2-yl)propanoate is sourced from PubChem (CID 10016853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).